Maleimidopropionyl PEG-27 NHS ester ( CAS: 2229707-72-4)

Maleimidopropionyl PEG-27 NHS ester, Special Reagents, PEG esters & acids
CAS Number 2229707-72-4
Catalogue number 21138-2795
Molecular weight 1570.8
n 27
Purity >95%
Price 100mg: 300 EUR, 1g: 1080 EUR

SMILES: O=C(CCN1C(C=CC1=O)=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(ON2C(CCC2=O)=O)=O

Alternative names: 2,5-Dioxopyrrolidin-1-yl 1-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)-3-oxo-7,10,13,16,19,22,25,28,31,34,37,40,43,46,49,52,55,58,61,64,67,70,73,76,79,82,85,88-octacosaoxa-4-azahennonacontan-91-oate
Application: The maleimidopriopionyl group reacts specifically with thiol (–SH) groups to form stable thioether bonds, while the NHS ester reacts with primary amines (–NH₂) to form stable amide bonds. This selectivity allows for controlled, stepwise conjugation under mild conditions. Heterobifunctional property, makes it especially useful for linking biomolecules in a precise way, such as attaching proteins, peptides, drugs, or targeting ligands to surfaces, nanoparticles, or other substrates in drug delivery and bioconjugation.